C12H13Cl2N3O — CID 63224591
1-(1-cyanopropan-2-yl)-3-(2,5-dichlorophenyl)-1-methylurea (PubChem CID 63224591) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-(1-cyanopropan-2-yl)-3-(2,5-dichlorophenyl)-1-methylurea.
| Compound Name | 1-(1-cyanopropan-2-yl)-3-(2,5-dichlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 63224591 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-(1-cyanopropan-2-yl)-3-(2,5-dichlorophenyl)-1-methylurea |
| SMILES | CC(CC#N)N(C)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O/c1-8(5-6-15)17(2)12(18)16-11-7-9(13)3-4-10(11)14/h3-4,7-8H,5H2,1-2H3,(H,16,18) |
| InChIKey | RGYFZYGSNPRIHJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |