C14H21N3 — CID 63225261
3-[[2-amino-1-(4-methylphenyl)ethyl]-methylamino]butanenitrile (PubChem CID 63225261) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[[2-amino-1-(4-methylphenyl)ethyl]-methylamino]butanenitrile.
| Compound Name | 3-[[2-amino-1-(4-methylphenyl)ethyl]-methylamino]butanenitrile |
|---|---|
| PubChem CID | 63225261 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-[[2-amino-1-(4-methylphenyl)ethyl]-methylamino]butanenitrile |
| SMILES | Cc1ccc(C(CN)N(C)C(C)CC#N)cc1 |
| InChI | InChI=1S/C14H21N3/c1-11-4-6-13(7-5-11)14(10-16)17(3)12(2)8-9-15/h4-7,12,14H,8,10,16H2,1-3H3 |
| InChIKey | JYKDYAAWMQIGDT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |