C12H16N2 — CID 82111722
3-(N,4-dimethylanilino)butanenitrile (PubChem CID 82111722) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(N,4-dimethylanilino)butanenitrile.
| Compound Name | 3-(N,4-dimethylanilino)butanenitrile |
|---|---|
| PubChem CID | 82111722 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-(N,4-dimethylanilino)butanenitrile |
| SMILES | Cc1ccc(N(C)C(C)CC#N)cc1 |
| InChI | InChI=1S/C12H16N2/c1-10-4-6-12(7-5-10)14(3)11(2)8-9-13/h4-7,11H,8H2,1-3H3 |
| InChIKey | WJLUSARXDXEKFU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|