C10H17F3N2O — CID 63226480
1-piperidin-1-yl-2-(3,3,3-trifluoropropylamino)ethanone (PubChem CID 63226480) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-(3,3,3-trifluoropropylamino)ethanone.
| Compound Name | 1-piperidin-1-yl-2-(3,3,3-trifluoropropylamino)ethanone |
|---|---|
| PubChem CID | 63226480 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-piperidin-1-yl-2-(3,3,3-trifluoropropylamino)ethanone |
| SMILES | O=C(CNCCC(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C10H17F3N2O/c11-10(12,13)4-5-14-8-9(16)15-6-2-1-3-7-15/h14H,1-8H2 |
| InChIKey | LTUWKCNESFONKX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|