C10H17F3N2O2 — CID 82721281
1-(azepan-1-yl)-2-(2,2,2-trifluoroethoxyamino)ethanone (PubChem CID 82721281) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-(2,2,2-trifluoroethoxyamino)ethanone.
| Compound Name | 1-(azepan-1-yl)-2-(2,2,2-trifluoroethoxyamino)ethanone |
|---|---|
| PubChem CID | 82721281 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-(azepan-1-yl)-2-(2,2,2-trifluoroethoxyamino)ethanone |
| SMILES | O=C(CNOCC(F)(F)F)N1CCCCCC1 |
| InChI | InChI=1S/C10H17F3N2O2/c11-10(12,13)8-17-14-7-9(16)15-5-3-1-2-4-6-15/h14H,1-8H2 |
| InChIKey | AEVABLXFDIUOGX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|