About 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene
1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene (PubChem CID 632304) has the molecular formula C16H8Br2
and a molecular weight of 360.05 g/mol. Its IUPAC name is 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene |
| PubChem CID | 632304 |
| Molecular Formula | C16H8Br2 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.90 |
| IUPAC Name | 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene |
| SMILES | Brc1ccc(C#CC#Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H8Br2/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h5-12H |
| InChIKey | IIERBCCHBFZMQZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene?
The IUPAC name of 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene (CID 632304) is 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene.
What is the SMILES notation for 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene?
The canonical SMILES for 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene is Brc1ccc(C#CC#Cc2ccc(Br)cc2)cc1.
What is the InChIKey of 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene?
The InChIKey is IIERBCCHBFZMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Br2/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h5-12H.
What are the key properties of 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene?
1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene has a molecular weight of 360.05 g/mol, XLogP of 4.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[4-(4-bromophenyl)buta-1,3-diynyl]benzene is sourced from PubChem (CID 632304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).