C10H5Cl3N2O2 — CID 63232149
2,8-dichloro-3-(chloromethyl)-6-nitroquinoline (PubChem CID 63232149) has the molecular formula C10H5Cl3N2O2 and a molecular weight of 291.52 g/mol. Its IUPAC name is 2,8-dichloro-3-(chloromethyl)-6-nitroquinoline.
| Compound Name | 2,8-dichloro-3-(chloromethyl)-6-nitroquinoline |
|---|---|
| PubChem CID | 63232149 |
| Molecular Formula | C10H5Cl3N2O2 |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 2,8-dichloro-3-(chloromethyl)-6-nitroquinoline |
| SMILES | O=[N+]([O-])c1cc(Cl)c2nc(Cl)c(CCl)cc2c1 |
| InChI | InChI=1S/C10H5Cl3N2O2/c11-4-6-1-5-2-7(15(16)17)3-8(12)9(5)14-10(6)13/h1-3H,4H2 |
| InChIKey | ZYHAVBPOAWFTML-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|