C27H42O6 — CID 632342
5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',14,16-tetrol (PubChem CID 632342) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is 5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',14,16-tetrol.
| Compound Name | 5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',14,16-tetrol |
|---|---|
| PubChem CID | 632342 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',14,16-tetrol |
| SMILES | CC1COC2(OC3CC4C5CC=C6CC(O)CC(O)C6(C)C5CCC4(C)C3C2C)C(O)C1O |
| InChI | InChI=1S/C27H42O6/c1-13-12-32-27(24(31)23(13)30)14(2)22-20(33-27)11-19-17-6-5-15-9-16(28)10-21(29)26(15,4)18(17)7-8-25(19,22)3/h5,13-14,16-24,28-31H,6-12H2,1-4H3 |
| InChIKey | YKEDJRDTHURFJC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|