C27H42O4 — CID 11517602
(5'S,7R,9S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14,16-diol (PubChem CID 11517602) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is (5'S,7R,9S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14,16-diol.
| Compound Name | (5'S,7R,9S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14,16-diol |
|---|---|
| PubChem CID | 11517602 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (5'S,7R,9S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14,16-diol |
| SMILES | CC1C2C(CC3C4CC=C5CC(O)CC(O)[C@]5(C)C4CC[C@@]32C)OC12CC[C@H](C)CO2 |
| InChI | InChI=1S/C27H42O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)13-21-19-6-5-17-11-18(28)12-23(29)26(17,4)20(19)8-9-25(21,24)3/h5,15-16,18-24,28-29H,6-14H2,1-4H3/t15-,16?,18?,19?,20?,21?,22?,23?,24?,25-,26-,27?/m0/s1 |
| InChIKey | QMQIQBOGXYYATH-PSAJDHTOSA-N |
| XLogP | 4.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|