C26H40O4 — CID 71216920
(1S,2S,5'R,6R,7S,9S,12S,13R,16S)-5',9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-7,16-diol (PubChem CID 71216920) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is (1S,2S,5'R,6R,7S,9S,12S,13R,16S)-5',9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-7,16-diol.
| Compound Name | (1S,2S,5'R,6R,7S,9S,12S,13R,16S)-5',9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-7,16-diol |
|---|---|
| PubChem CID | 71216920 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (1S,2S,5'R,6R,7S,9S,12S,13R,16S)-5',9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-7,16-diol |
| SMILES | C[C@@H]1CC[C@@]2(OC1)OC1C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)C1C2O |
| InChI | InChI=1S/C26H40O4/c1-15-6-11-26(29-14-15)23(28)22-21(30-26)13-20-18-5-4-16-12-17(27)7-9-24(16,2)19(18)8-10-25(20,22)3/h4,15,17-23,27-28H,5-14H2,1-3H3/t15-,17+,18-,19+,20+,21?,22?,23?,24+,25+,26-/m1/s1 |
| InChIKey | NOALVNTUTPJGAA-USRXXZLHSA-N |
| XLogP | 4.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|