C16H22N2O2 — CID 63234920
[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-(oxan-4-yl)methanone (PubChem CID 63234920) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is [3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 63234920 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-(oxan-4-yl)methanone |
| SMILES | NCCC1CN(C(=O)C2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C16H22N2O2/c17-8-5-13-11-18(15-4-2-1-3-14(13)15)16(19)12-6-9-20-10-7-12/h1-4,12-13H,5-11,17H2 |
| InChIKey | CKUHVGCVSMIXFZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |