C16H26ClN3 — CID 63236337
3-(chloromethyl)-N,4,6-trimethyl-N-[(1-methylpiperidin-4-yl)methyl]pyridin-2-amine (PubChem CID 63236337) has the molecular formula C16H26ClN3 and a molecular weight of 295.86 g/mol. Its IUPAC name is 3-(chloromethyl)-N,4,6-trimethyl-N-[(1-methylpiperidin-4-yl)methyl]pyridin-2-amine.
| Compound Name | 3-(chloromethyl)-N,4,6-trimethyl-N-[(1-methylpiperidin-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 63236337 |
| Molecular Formula | C16H26ClN3 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-(chloromethyl)-N,4,6-trimethyl-N-[(1-methylpiperidin-4-yl)methyl]pyridin-2-amine |
| SMILES | Cc1cc(C)c(CCl)c(N(C)CC2CCN(C)CC2)n1 |
| InChI | InChI=1S/C16H26ClN3/c1-12-9-13(2)18-16(15(12)10-17)20(4)11-14-5-7-19(3)8-6-14/h9,14H,5-8,10-11H2,1-4H3 |
| InChIKey | BRVOVTBQYMMBMS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|