C14H18N2O2S2 — CID 63238013
2-(cyclopropylamino)-4-(4-methylsulfonylphenyl)sulfanylbutanenitrile (PubChem CID 63238013) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-(4-methylsulfonylphenyl)sulfanylbutanenitrile.
| Compound Name | 2-(cyclopropylamino)-4-(4-methylsulfonylphenyl)sulfanylbutanenitrile |
|---|---|
| PubChem CID | 63238013 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(cyclopropylamino)-4-(4-methylsulfonylphenyl)sulfanylbutanenitrile |
| SMILES | CS(=O)(=O)c1ccc(SCCC(C#N)NC2CC2)cc1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-20(17,18)14-6-4-13(5-7-14)19-9-8-12(10-15)16-11-2-3-11/h4-7,11-12,16H,2-3,8-9H2,1H3 |
| InChIKey | CJIJGXUEIDYKHA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |