C14H18N2O2S2 — CID 63907058
2-cyclopropyl-2-(methylamino)-3-(4-methylsulfonylphenyl)sulfanylpropanenitrile (PubChem CID 63907058) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-cyclopropyl-2-(methylamino)-3-(4-methylsulfonylphenyl)sulfanylpropanenitrile.
| Compound Name | 2-cyclopropyl-2-(methylamino)-3-(4-methylsulfonylphenyl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 63907058 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-cyclopropyl-2-(methylamino)-3-(4-methylsulfonylphenyl)sulfanylpropanenitrile |
| SMILES | CNC(C#N)(CSc1ccc(S(C)(=O)=O)cc1)C1CC1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-16-14(9-15,11-3-4-11)10-19-12-5-7-13(8-6-12)20(2,17)18/h5-8,11,16H,3-4,10H2,1-2H3 |
| InChIKey | RJNJJANOAWXUQT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |