C11H19N3OS — CID 63240745
N-[(4-methoxypyrrolidin-2-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 63240745) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N-[(4-methoxypyrrolidin-2-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[(4-methoxypyrrolidin-2-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 63240745 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-[(4-methoxypyrrolidin-2-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | COC1CNC(CNCCc2nccs2)C1 |
| InChI | InChI=1S/C11H19N3OS/c1-15-10-6-9(14-8-10)7-12-3-2-11-13-4-5-16-11/h4-5,9-10,12,14H,2-3,6-8H2,1H3 |
| InChIKey | IKEQWNNAEGJTKI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|