C15H32N2O3S — CID 63245674
N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-ethoxy-N-ethylethanesulfonamide (PubChem CID 63245674) has the molecular formula C15H32N2O3S and a molecular weight of 320.50 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-ethoxy-N-ethylethanesulfonamide.
| Compound Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-ethoxy-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 63245674 |
| Molecular Formula | C15H32N2O3S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-ethoxy-N-ethylethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)N(CC)C1(CN)CCC(CC)CC1 |
| InChI | InChI=1S/C15H32N2O3S/c1-4-14-7-9-15(13-16,10-8-14)17(5-2)21(18,19)12-11-20-6-3/h14H,4-13,16H2,1-3H3 |
| InChIKey | LULSNTJIAVCNGN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|