C13H28N2O4S2 — CID 82838643
N-[1-(aminomethyl)-4-ethylcyclohexyl]-N-ethyl-1-methylsulfonylmethanesulfonamide (PubChem CID 82838643) has the molecular formula C13H28N2O4S2 and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-ethylcyclohexyl]-N-ethyl-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-N-ethyl-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82838643 |
| Molecular Formula | C13H28N2O4S2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-N-ethyl-1-methylsulfonylmethanesulfonamide |
| SMILES | CCC1CCC(CN)(N(CC)S(=O)(=O)CS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H28N2O4S2/c1-4-12-6-8-13(10-14,9-7-12)15(5-2)21(18,19)11-20(3,16)17/h12H,4-11,14H2,1-3H3 |
| InChIKey | VRUFAYRTLRGLHU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |