C11H18N2O5S2 — CID 63246113
4-(2-ethoxyethylsulfonylamino)-2-methylbenzenesulfonamide (PubChem CID 63246113) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(2-ethoxyethylsulfonylamino)-2-methylbenzenesulfonamide.
| Compound Name | 4-(2-ethoxyethylsulfonylamino)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 63246113 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-(2-ethoxyethylsulfonylamino)-2-methylbenzenesulfonamide |
| SMILES | CCOCCS(=O)(=O)Nc1ccc(S(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C11H18N2O5S2/c1-3-18-6-7-19(14,15)13-10-4-5-11(9(2)8-10)20(12,16)17/h4-5,8,13H,3,6-7H2,1-2H3,(H2,12,16,17) |
| InChIKey | BOPGMKYNPUZVCC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|