C10H15FN2O5S2 — CID 63246071
4-(2-ethoxyethylsulfonylamino)-2-fluorobenzenesulfonamide (PubChem CID 63246071) has the molecular formula C10H15FN2O5S2 and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-(2-ethoxyethylsulfonylamino)-2-fluorobenzenesulfonamide.
| Compound Name | 4-(2-ethoxyethylsulfonylamino)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63246071 |
| Molecular Formula | C10H15FN2O5S2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-(2-ethoxyethylsulfonylamino)-2-fluorobenzenesulfonamide |
| SMILES | CCOCCS(=O)(=O)Nc1ccc(S(N)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C10H15FN2O5S2/c1-2-18-5-6-19(14,15)13-8-3-4-10(9(11)7-8)20(12,16)17/h3-4,7,13H,2,5-6H2,1H3,(H2,12,16,17) |
| InChIKey | ZPGXCPGPSKOMEC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|