C13H16FNO4S — CID 65436088
2-ethoxy-N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]ethanesulfonamide (PubChem CID 65436088) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-ethoxy-N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]ethanesulfonamide.
| Compound Name | 2-ethoxy-N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 65436088 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-ethoxy-N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]ethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)Nc1ccc(C#CCO)c(F)c1 |
| InChI | InChI=1S/C13H16FNO4S/c1-2-19-8-9-20(17,18)15-12-6-5-11(4-3-7-16)13(14)10-12/h5-6,10,15-16H,2,7-9H2,1H3 |
| InChIKey | GVGSMKYBORWLCI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|