C28H32O12 — CID 6325060
7-[(2S,3R,4S,6S)-3,4-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-(4-methoxyphenyl)chromen-4-one (PubChem CID 6325060) has the molecular formula C28H32O12 and a molecular weight of 560.55 g/mol. Its IUPAC name is 7-[(2S,3R,4S,6S)-3,4-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 7-[(2S,3R,4S,6S)-3,4-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 6325060 |
| Molecular Formula | C28H32O12 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 7-[(2S,3R,4S,6S)-3,4-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3cc(O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)C[C@H](O)[C@H]4O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C28H32O12/c1-13-22(30)25(33)26(34)27(38-13)37-11-17-9-20(29)24(32)28(40-17)39-16-7-8-18-21(10-16)36-12-19(23(18)31)14-3-5-15(35-2)6-4-14/h3-8,10,12-13,17,20,22,24-30,32-34H,9,11H2,1-2H3/t13-,17-,20-,22-,24+,25+,26+,27+,28+/m0/s1 |
| InChIKey | SOBUNGYBADTGQJ-ZIEHOKHKSA-N |
| XLogP | 0.53 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |