C15H20IN3O2 — CID 63251979
N-(2-aminoethyl)-1-(2-iodobenzoyl)piperidine-3-carboxamide (PubChem CID 63251979) has the molecular formula C15H20IN3O2 and a molecular weight of 401.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(2-iodobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(2-iodobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63251979 |
| Molecular Formula | C15H20IN3O2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-(2-aminoethyl)-1-(2-iodobenzoyl)piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)c2ccccc2I)C1 |
| InChI | InChI=1S/C15H20IN3O2/c16-13-6-2-1-5-12(13)15(21)19-9-3-4-11(10-19)14(20)18-8-7-17/h1-2,5-6,11H,3-4,7-10,17H2,(H,18,20) |
| InChIKey | FOEINRPAKKECQT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|