C17H24N2O2 — CID 63256117
1-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-2-ylpiperidine (PubChem CID 63256117) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 63256117 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-2-ylpiperidine |
| SMILES | c1cc2c(cc1CN1CCC(C3CCCN3)CC1)OCO2 |
| InChI | InChI=1S/C17H24N2O2/c1-2-15(18-7-1)14-5-8-19(9-6-14)11-13-3-4-16-17(10-13)21-12-20-16/h3-4,10,14-15,18H,1-2,5-9,11-12H2 |
| InChIKey | TZYRSZJPUQOOTL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |