C16H24N2O2 — CID 64950183
1-(1,3-benzodioxol-5-ylmethyl)-3-propyl-1,4-diazepane (PubChem CID 64950183) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-propyl-1,4-diazepane.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-propyl-1,4-diazepane |
|---|---|
| PubChem CID | 64950183 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-propyl-1,4-diazepane |
| SMILES | CCCC1CN(Cc2ccc3c(c2)OCO3)CCCN1 |
| InChI | InChI=1S/C16H24N2O2/c1-2-4-14-11-18(8-3-7-17-14)10-13-5-6-15-16(9-13)20-12-19-15/h5-6,9,14,17H,2-4,7-8,10-12H2,1H3 |
| InChIKey | RJMWMIIPHWUUSI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |