C8H9N5 — CID 63260041
5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridin-2-amine (PubChem CID 63260041) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridin-2-amine.
| Compound Name | 5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 63260041 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridin-2-amine |
| SMILES | Cc1nc(-c2ccc(N)nc2)n[nH]1 |
| InChI | InChI=1S/C8H9N5/c1-5-11-8(13-12-5)6-2-3-7(9)10-4-6/h2-4H,1H3,(H2,9,10)(H,11,12,13) |
| InChIKey | AUNMGGXHJJJNFW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |