C12H25N5O2 — CID 63266126
N-(methylcarbamoyl)-2-[methyl(2-piperazin-1-ylethyl)amino]propanamide (PubChem CID 63266126) has the molecular formula C12H25N5O2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(methylcarbamoyl)-2-[methyl(2-piperazin-1-ylethyl)amino]propanamide.
| Compound Name | N-(methylcarbamoyl)-2-[methyl(2-piperazin-1-ylethyl)amino]propanamide |
|---|---|
| PubChem CID | 63266126 |
| Molecular Formula | C12H25N5O2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-(methylcarbamoyl)-2-[methyl(2-piperazin-1-ylethyl)amino]propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N(C)CCN1CCNCC1 |
| InChI | InChI=1S/C12H25N5O2/c1-10(11(18)15-12(19)13-2)16(3)8-9-17-6-4-14-5-7-17/h10,14H,4-9H2,1-3H3,(H2,13,15,18,19) |
| InChIKey | WYUVFPAITWIBRO-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |