C12H18N4O3S — CID 63270780
N-(3-amino-3-sulfanylidenepropyl)-2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylacetamide (PubChem CID 63270780) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylacetamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 63270780 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylacetamide |
| SMILES | Cc1c(C)c(=O)n(CC(=O)N(C)CCC(N)=S)[nH]c1=O |
| InChI | InChI=1S/C12H18N4O3S/c1-7-8(2)12(19)16(14-11(7)18)6-10(17)15(3)5-4-9(13)20/h4-6H2,1-3H3,(H2,13,20)(H,14,18) |
| InChIKey | YAXQINKNERIJSH-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|