C10H14N2O4 — CID 63271349
4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)butanoic acid (PubChem CID 63271349) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)butanoic acid.
| Compound Name | 4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 63271349 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)butanoic acid |
| SMILES | Cc1c(C)c(=O)n(CCCC(=O)O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4/c1-6-7(2)10(16)12(11-9(6)15)5-3-4-8(13)14/h3-5H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | DFCBIOHYDPDBKN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |