C10H14N2O4 — CID 65248241
4-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanoic acid (PubChem CID 65248241) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanoic acid.
| Compound Name | 4-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65248241 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCn1[nH]c(=O)ccc1=O)C(=O)O |
| InChI | InChI=1S/C10H14N2O4/c1-10(2,9(15)16)5-6-12-8(14)4-3-7(13)11-12/h3-4H,5-6H2,1-2H3,(H,11,13)(H,15,16) |
| InChIKey | SRBLYMKXJIQTLO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |