C11H15ClN2O2 — CID 63271996
3-chloro-4,5-dimethyl-6-(oxolan-2-ylmethoxy)pyridazine (PubChem CID 63271996) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 3-chloro-4,5-dimethyl-6-(oxolan-2-ylmethoxy)pyridazine.
| Compound Name | 3-chloro-4,5-dimethyl-6-(oxolan-2-ylmethoxy)pyridazine |
|---|---|
| PubChem CID | 63271996 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-chloro-4,5-dimethyl-6-(oxolan-2-ylmethoxy)pyridazine |
| SMILES | Cc1c(Cl)nnc(OCC2CCCO2)c1C |
| InChI | InChI=1S/C11H15ClN2O2/c1-7-8(2)11(14-13-10(7)12)16-6-9-4-3-5-15-9/h9H,3-6H2,1-2H3 |
| InChIKey | NGNGWVCJZQAVJA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |