C11H11NO3 — CID 63272630
2-cyano-2-(4-ethoxyphenyl)acetic acid (PubChem CID 63272630) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-cyano-2-(4-ethoxyphenyl)acetic acid.
| Compound Name | 2-cyano-2-(4-ethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 63272630 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-cyano-2-(4-ethoxyphenyl)acetic acid |
| SMILES | CCOc1ccc(C(C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C11H11NO3/c1-2-15-9-5-3-8(4-6-9)10(7-12)11(13)14/h3-6,10H,2H2,1H3,(H,13,14) |
| InChIKey | KLANNVAEZATGSP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |