C18H25NO2 — CID 63833452
2-(4-ethoxyphenyl)-5,6,6-trimethyl-3-oxoheptanenitrile (PubChem CID 63833452) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5,6,6-trimethyl-3-oxoheptanenitrile.
| Compound Name | 2-(4-ethoxyphenyl)-5,6,6-trimethyl-3-oxoheptanenitrile |
|---|---|
| PubChem CID | 63833452 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5,6,6-trimethyl-3-oxoheptanenitrile |
| SMILES | CCOc1ccc(C(C#N)C(=O)CC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-6-21-15-9-7-14(8-10-15)16(12-19)17(20)11-13(2)18(3,4)5/h7-10,13,16H,6,11H2,1-5H3 |
| InChIKey | JIMFTFGAIZHPKF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |