C13H11F2N3O3 — CID 63273017
[4-[(2,5-difluorophenoxy)methyl]-2-nitrophenyl]hydrazine (PubChem CID 63273017) has the molecular formula C13H11F2N3O3 and a molecular weight of 295.25 g/mol. Its IUPAC name is [4-[(2,5-difluorophenoxy)methyl]-2-nitrophenyl]hydrazine.
| Compound Name | [4-[(2,5-difluorophenoxy)methyl]-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 63273017 |
| Molecular Formula | C13H11F2N3O3 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [4-[(2,5-difluorophenoxy)methyl]-2-nitrophenyl]hydrazine |
| SMILES | NNc1ccc(COc2cc(F)ccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11F2N3O3/c14-9-2-3-10(15)13(6-9)21-7-8-1-4-11(17-16)12(5-8)18(19)20/h1-6,17H,7,16H2 |
| InChIKey | MDKLKNANPSGBAO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|