C10H10F5N3O3 — CID 79589871
[2-nitro-4-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]hydrazine (PubChem CID 79589871) has the molecular formula C10H10F5N3O3 and a molecular weight of 315.20 g/mol. Its IUPAC name is [2-nitro-4-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]hydrazine.
| Compound Name | [2-nitro-4-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 79589871 |
| Molecular Formula | C10H10F5N3O3 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | [2-nitro-4-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]hydrazine |
| SMILES | NNc1ccc(COCC(F)(F)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10F5N3O3/c11-9(12,10(13,14)15)5-21-4-6-1-2-7(17-16)8(3-6)18(19)20/h1-3,17H,4-5,16H2 |
| InChIKey | IJYJHAAZWKUSEX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|