About Stannane, trimethyl-(trimethylsilyl)-
Stannane, trimethyl-(trimethylsilyl)- (PubChem CID 6327329) has the molecular formula C6H18SiSn
and a molecular weight of 237.01 g/mol.
Molecular Properties
| Compound Name | Stannane, trimethyl-(trimethylsilyl)- |
| PubChem CID | 6327329 |
| Molecular Formula | C6H18SiSn |
| Molecular Weight | 237.01 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | — |
| SMILES | C[Si](C)C.C[Sn](C)C |
| InChI | InChI=1S/C3H9Si.3CH3.Sn/c1-4(2)3;;;;/h1-3H3;3*1H3; |
| InChIKey | ISPIFJDNUPHRNL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.01 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Stannane, trimethyl-(trimethylsilyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Stannane, trimethyl-(trimethylsilyl)-?
The IUPAC name of Stannane, trimethyl-(trimethylsilyl)- (CID 6327329) is not available.
What is the SMILES notation for Stannane, trimethyl-(trimethylsilyl)-?
The canonical SMILES for Stannane, trimethyl-(trimethylsilyl)- is C[Si](C)C.C[Sn](C)C.
What is the InChIKey of Stannane, trimethyl-(trimethylsilyl)-?
The InChIKey is ISPIFJDNUPHRNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9Si.3CH3.Sn/c1-4(2)3;;;;/h1-3H3;3*1H3;.
What are the key properties of Stannane, trimethyl-(trimethylsilyl)-?
Stannane, trimethyl-(trimethylsilyl)- has a molecular weight of 237.01 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Stannane, trimethyl-(trimethylsilyl)- is sourced from PubChem (CID 6327329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).