C14H19F3N2O2 — CID 63280129
1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 63280129) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 63280129 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(NCCn1cc(C(F)(F)F)ccc1=O)C1CCCO1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-10(12-3-2-8-21-12)18-6-7-19-9-11(14(15,16)17)4-5-13(19)20/h4-5,9-10,12,18H,2-3,6-8H2,1H3 |
| InChIKey | VYQPNGUBAVHGOP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |