C14H27N3O2S — CID 63285116
2-[(3-amino-3-sulfanylidenepropyl)-(2-methoxyethyl)amino]-N-cyclohexylacetamide (PubChem CID 63285116) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is 2-[(3-amino-3-sulfanylidenepropyl)-(2-methoxyethyl)amino]-N-cyclohexylacetamide.
| Compound Name | 2-[(3-amino-3-sulfanylidenepropyl)-(2-methoxyethyl)amino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 63285116 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[(3-amino-3-sulfanylidenepropyl)-(2-methoxyethyl)amino]-N-cyclohexylacetamide |
| SMILES | COCCN(CCC(N)=S)CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H27N3O2S/c1-19-10-9-17(8-7-13(15)20)11-14(18)16-12-5-3-2-4-6-12/h12H,2-11H2,1H3,(H2,15,20)(H,16,18) |
| InChIKey | XIXSQUNXSVQILY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|