C34H38GeSi2 — CID 6329079
1,1-Ditrimethylsilyl,-2,3,4,5-tetraphenyl-germacyclopenta-2,4-diene (PubChem CID 6329079) has the molecular formula C34H38GeSi2 and a molecular weight of 575.46 g/mol.
| Compound Name | 1,1-Ditrimethylsilyl,-2,3,4,5-tetraphenyl-germacyclopenta-2,4-diene |
|---|---|
| PubChem CID | 6329079 |
| Molecular Formula | C34H38GeSi2 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | — |
| SMILES | C[Si](C)C.C[Si](C)C.c1ccc(C2=C(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)[Ge]2)cc1 |
| InChI | InChI=1S/C28H20Ge.2C3H9Si/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23;2*1-4(2)3/h1-20H;2*1-3H3 |
| InChIKey | YKGBBCLXXPETTD-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|