5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid

C10H8FN3O2 — CID 63292739

IUPAC5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid
SMILESO=C(O)c1cc(F)ccc1Cn1cncn1
InChIInChI=1S/C10H8FN3O2/c11-8-2-1-7(9(3-8)10(15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H,15,16)
InChIKeyCXQDIZWHICLWOU-UHFFFAOYSA-N
MW221.19 g/mol
LogP1.16
Rot. Bonds3

About 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid

5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid (PubChem CID 63292739) has the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. Its IUPAC name is 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid.

Molecular Properties

Compound Name5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid
PubChem CID63292739
Molecular FormulaC10H8FN3O2
Molecular Weight221.19 g/mol
Exact Mass221.06
IUPAC Name5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid
SMILESO=C(O)c1cc(F)ccc1Cn1cncn1
InChIInChI=1S/C10H8FN3O2/c11-8-2-1-7(9(3-8)10(15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H,15,16)
InChIKeyCXQDIZWHICLWOU-UHFFFAOYSA-N
XLogP1.16
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.19
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid?
The IUPAC name of 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid (CID 63292739) is 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid.
What is the SMILES notation for 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid?
The canonical SMILES for 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid is O=C(O)c1cc(F)ccc1Cn1cncn1.
What is the InChIKey of 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid?
The InChIKey is CXQDIZWHICLWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN3O2/c11-8-2-1-7(9(3-8)10(15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H,15,16).
What are the key properties of 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid?
5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid has a molecular weight of 221.19 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid is sourced from PubChem (CID 63292739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).