C10H8FN3O2 — CID 63292739
5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid (PubChem CID 63292739) has the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. Its IUPAC name is 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid.
| Compound Name | 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 63292739 |
| Molecular Formula | C10H8FN3O2 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 5-fluoro-2-(1,2,4-triazol-1-ylmethyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1Cn1cncn1 |
| InChI | InChI=1S/C10H8FN3O2/c11-8-2-1-7(9(3-8)10(15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H,15,16) |
| InChIKey | CXQDIZWHICLWOU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |