About 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid
3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid (PubChem CID 63640369) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid.
Analyze 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
The IUPAC name of 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid (CID 63640369) is 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
The canonical SMILES for 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid is O=C(O)c1sccc1Cn1cncn1.
What is the InChIKey of 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
The InChIKey is BGJRQYNZYQPBON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c12-8(13)7-6(1-2-14-7)3-11-5-9-4-10-11/h1-2,4-5H,3H2,(H,12,13).
What are the key properties of 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid has a molecular weight of 209.23 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 63640369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).