C7H13F2NO — CID 63298404
1-cyclopropyl-2-(2,2-difluoroethylamino)ethanol (PubChem CID 63298404) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,2-difluoroethylamino)ethanol.
| Compound Name | 1-cyclopropyl-2-(2,2-difluoroethylamino)ethanol |
|---|---|
| PubChem CID | 63298404 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 1-cyclopropyl-2-(2,2-difluoroethylamino)ethanol |
| SMILES | OC(CNCC(F)F)C1CC1 |
| InChI | InChI=1S/C7H13F2NO/c8-7(9)4-10-3-6(11)5-1-2-5/h5-7,10-11H,1-4H2 |
| InChIKey | URAAKFMSCKZUAP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |