C11H23NO3 — CID 81094787
1-cyclopropyl-2-(2,2-diethoxyethylamino)ethanol (PubChem CID 81094787) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,2-diethoxyethylamino)ethanol.
| Compound Name | 1-cyclopropyl-2-(2,2-diethoxyethylamino)ethanol |
|---|---|
| PubChem CID | 81094787 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 1-cyclopropyl-2-(2,2-diethoxyethylamino)ethanol |
| SMILES | CCOC(CNCC(O)C1CC1)OCC |
| InChI | InChI=1S/C11H23NO3/c1-3-14-11(15-4-2)8-12-7-10(13)9-5-6-9/h9-13H,3-8H2,1-2H3 |
| InChIKey | RPTVFRJVIJBKDE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|