C14H20N4O2 — CID 63302271
1-cyclopentyl-3-[(2-methylpyrazol-3-yl)methylamino]pyrrolidine-2,5-dione (PubChem CID 63302271) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(2-methylpyrazol-3-yl)methylamino]pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopentyl-3-[(2-methylpyrazol-3-yl)methylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 63302271 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-cyclopentyl-3-[(2-methylpyrazol-3-yl)methylamino]pyrrolidine-2,5-dione |
| SMILES | Cn1nccc1CNC1CC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C14H20N4O2/c1-17-11(6-7-16-17)9-15-12-8-13(19)18(14(12)20)10-4-2-3-5-10/h6-7,10,12,15H,2-5,8-9H2,1H3 |
| InChIKey | QHOGPSSEDDHSBS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|