C12H18N2 — CID 63305633
1-cyclopropyl-N-[(3-methyl-2-pyridinyl)methyl]ethanamine (PubChem CID 63305633) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(3-methyl-2-pyridinyl)methyl]ethanamine.
| Compound Name | 1-cyclopropyl-N-[(3-methyl-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63305633 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-cyclopropyl-N-[(3-methyl-2-pyridinyl)methyl]ethanamine |
| SMILES | Cc1cccnc1CNC(C)C1CC1 |
| InChI | InChI=1S/C12H18N2/c1-9-4-3-7-13-12(9)8-14-10(2)11-5-6-11/h3-4,7,10-11,14H,5-6,8H2,1-2H3 |
| InChIKey | KOEZHROIJGCUBU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |