C15H22N2O2 — CID 114198751
2-[[[(1S)-1-cyclohexylethyl]amino]methyl]pyridine-3-carboxylic acid (PubChem CID 114198751) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[[[(1S)-1-cyclohexylethyl]amino]methyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[[(1S)-1-cyclohexylethyl]amino]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114198751 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-[[[(1S)-1-cyclohexylethyl]amino]methyl]pyridine-3-carboxylic acid |
| SMILES | C[C@H](NCc1ncccc1C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-11(12-6-3-2-4-7-12)17-10-14-13(15(18)19)8-5-9-16-14/h5,8-9,11-12,17H,2-4,6-7,10H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | ODJHFRZRZRAUFM-NSHDSACASA-N |
| XLogP | 2.84 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |