C12H21ClN2O2 — CID 63307556
4-chloro-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)butanamide (PubChem CID 63307556) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is 4-chloro-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)butanamide.
| Compound Name | 4-chloro-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)butanamide |
|---|---|
| PubChem CID | 63307556 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-chloro-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)butanamide |
| SMILES | CC(NC(=O)CCCCl)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H21ClN2O2/c1-10(14-11(16)6-5-7-13)12(17)15-8-3-2-4-9-15/h10H,2-9H2,1H3,(H,14,16) |
| InChIKey | VRQYPWCEJKULPY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|