C12H13Cl2N3O — CID 63310933
1-[3-(2,4-dichlorophenoxy)propyl]pyrazol-3-amine (PubChem CID 63310933) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenoxy)propyl]pyrazol-3-amine.
| Compound Name | 1-[3-(2,4-dichlorophenoxy)propyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 63310933 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-[3-(2,4-dichlorophenoxy)propyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCCOc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H13Cl2N3O/c13-9-2-3-11(10(14)8-9)18-7-1-5-17-6-4-12(15)16-17/h2-4,6,8H,1,5,7H2,(H2,15,16) |
| InChIKey | CGMAOURTTZITJA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|