C12H17NO5S — CID 63311718
ethyl 2-[[3-(hydroxymethyl)phenyl]methylsulfamoyl]acetate (PubChem CID 63311718) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 2-[[3-(hydroxymethyl)phenyl]methylsulfamoyl]acetate.
| Compound Name | ethyl 2-[[3-(hydroxymethyl)phenyl]methylsulfamoyl]acetate |
|---|---|
| PubChem CID | 63311718 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | ethyl 2-[[3-(hydroxymethyl)phenyl]methylsulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)NCc1cccc(CO)c1 |
| InChI | InChI=1S/C12H17NO5S/c1-2-18-12(15)9-19(16,17)13-7-10-4-3-5-11(6-10)8-14/h3-6,13-14H,2,7-9H2,1H3 |
| InChIKey | QZXFNAKGROIGNV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |