C17H18N2NaO4S — CID 6331345
CID 6331345 (PubChem CID 6331345) has the molecular formula C17H18N2NaO4S and a molecular weight of 369.40 g/mol.
| Compound Name | CID 6331345 |
|---|---|
| PubChem CID | 6331345 |
| Molecular Formula | C17H18N2NaO4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | — |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C=Cc3ccccc3)C(=O)N2[C@H]1C(=O)O.[Na] |
| InChI | InChI=1S/C17H18N2O4S.Na/c1-17(2)13(16(22)23)19-14(21)12(15(19)24-17)18-11(20)9-8-10-6-4-3-5-7-10;/h3-9,12-13,15H,1-2H3,(H,18,20)(H,22,23);/t12-,13+,15-;/m1./s1 |
| InChIKey | FTJUIACBYFRUKK-ZCGPAKHCSA-N |
| XLogP | 0.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|