C9H20N4 — CID 63316564
2-[2-[cyclopentyl(methyl)amino]ethyl]guanidine (PubChem CID 63316564) has the molecular formula C9H20N4 and a molecular weight of 184.29 g/mol. Its IUPAC name is 2-[2-[cyclopentyl(methyl)amino]ethyl]guanidine.
| Compound Name | 2-[2-[cyclopentyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 63316564 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | 2-[2-[cyclopentyl(methyl)amino]ethyl]guanidine |
| SMILES | CN(CCN=C(N)N)C1CCCC1 |
| InChI | InChI=1S/C9H20N4/c1-13(7-6-12-9(10)11)8-4-2-3-5-8/h8H,2-7H2,1H3,(H4,10,11,12) |
| InChIKey | PKTYVAIHZQGZMM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|